Products 481-90-3
CAS 481-90-3 is the registry number for Adrenaline Impurity 51. Offered by: Chemat Brand. Available pack sizes: on request.
2-(methylaminomethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-5,6,13,14-tetrol (CAS 481-90-3) is a chemical compound with the molecular formula C17H17NO4 and a molecular weight of 299.32 g/mol. IUPAC name: 2-(methylaminomethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-5,6,13,14-tetrol. InChIKey: LTLXWGYCUKUMBX-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4 |
|---|---|
| Molecular weight | 299.32 g/mol |
| IUPAC name | 2-(methylaminomethyl)tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-5,6,13,14-tetrol |
| InChIKey | LTLXWGYCUKUMBX-UHFFFAOYSA-N |
| SMILES | CNCC1C2=CC(=C(C=C2C=CC3=CC(=C(C=C13)O)O)O)O |
Computed by PubChem (NCBI)