Products 483-85-2

CAS 483-85-2 is the registry number for 2-formyl-3,4-dimethoxybenzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-formyl-3,4-dimethoxybenzoic acid (CAS 483-85-2) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: 2-formyl-3,4-dimethoxybenzoic acid. InChIKey: KMPIRHZKOQIJDD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O5
Molecular weight210.18 g/mol
IUPAC name2-formyl-3,4-dimethoxybenzoic acid
InChIKeyKMPIRHZKOQIJDD-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)C(=O)O)C=O)OC

Computed by PubChem (NCBI)