CAS 484-66-2 is the registry number for 2,3,4,5,6-Pentamethylbenzyl alcohol, 98%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2,3,4,5,6-pentamethylphenyl)methanol (CAS 484-66-2) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: (2,3,4,5,6-pentamethylphenyl)methanol. InChIKey: CMBCAWNOBIGGTE-UHFFFAOYSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | (2,3,4,5,6-pentamethylphenyl)methanol |
| InChIKey | CMBCAWNOBIGGTE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)CO)C)C |
Computed by PubChem (NCBI)