Products 4857-94-7
CAS 4857-94-7 is the registry number for 4-Amino-2,5-dichloro-benzenesulfonyl chloride, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
4-amino-2,5-dichlorobenzenesulfonyl chloride (CAS 4857-94-7) is a chemical compound with the molecular formula C6H4Cl3NO2S and a molecular weight of 260.5 g/mol. IUPAC name: 4-amino-2,5-dichlorobenzenesulfonyl chloride. InChIKey: BAWYRVMRUXDHTQ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl3NO2S |
|---|---|
| Molecular weight | 260.5 g/mol |
| IUPAC name | 4-amino-2,5-dichlorobenzenesulfonyl chloride |
| InChIKey | BAWYRVMRUXDHTQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)S(=O)(=O)Cl)Cl)N |
Computed by PubChem (NCBI)