Products 4865-62-7
CAS 4865-62-7 appears in our catalog under these names: 3,4–Dimethylmethcathinone metabolite (hydrochloride) ((±)–Pseudoephedrine stereochemistry), 3,4-DMMC metabolite (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 500μg, 5 mg, 1 mg.
(1R,2R)-1-(3,4-dimethylphenyl)-2-(methylamino)propan-1-ol;hydrochloride (CAS 4865-62-7) is a chemical compound with the molecular formula C12H20ClNO and a molecular weight of 229.74 g/mol. IUPAC name: (1R,2R)-1-(3,4-dimethylphenyl)-2-(methylamino)propan-1-ol;hydrochloride. InChIKey: KHXAWXPKWFWNPE-IYJPBCIQSA-N.
| Molecular formula | C12H20ClNO |
|---|---|
| Molecular weight | 229.74 g/mol |
| IUPAC name | (1R,2R)-1-(3,4-dimethylphenyl)-2-(methylamino)propan-1-ol;hydrochloride |
| InChIKey | KHXAWXPKWFWNPE-IYJPBCIQSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@H]([C@@H](C)NC)O)C.Cl |
Computed by PubChem (NCBI)