CAS 486994-09-6 appears in our catalog under these names: 2-Bromo-5-ethoxy-4-isopropoxybenzaldehyde, 95%, 2-Bromo-5-ethoxy-4-isopropoxybenzaldehyde, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-bromo-5-ethoxy-4-propan-2-yloxybenzaldehyde (CAS 486994-09-6) is a chemical compound with the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. IUPAC name: 2-bromo-5-ethoxy-4-propan-2-yloxybenzaldehyde. InChIKey: INWGJALHGYWTSF-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO3 |
|---|---|
| Molecular weight | 287.15 g/mol |
| IUPAC name | 2-bromo-5-ethoxy-4-propan-2-yloxybenzaldehyde |
| InChIKey | INWGJALHGYWTSF-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C=O)Br)OC(C)C |
Computed by PubChem (NCBI)