Products 489429-72-3
CAS 489429-72-3 appears in our catalog under these names: 1-(2-Amino-3-methoxyphenyl)-2,2,2-trifluoroethanone, 95%, 1-(2-Amino-3-methoxyphenyl)-2,2,2-trifluoroethanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1-(2-amino-3-methoxyphenyl)-2,2,2-trifluoroethanone (CAS 489429-72-3) is a chemical compound with the molecular formula C9H8F3NO2 and a molecular weight of 219.16 g/mol. IUPAC name: 1-(2-amino-3-methoxyphenyl)-2,2,2-trifluoroethanone. InChIKey: XIRKNTLEMGPMBX-UHFFFAOYSA-N.
| Molecular formula | C9H8F3NO2 |
|---|---|
| Molecular weight | 219.16 g/mol |
| IUPAC name | 1-(2-amino-3-methoxyphenyl)-2,2,2-trifluoroethanone |
| InChIKey | XIRKNTLEMGPMBX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1N)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)