Products 489457-67-2
CAS 489457-67-2 appears in our catalog under these names: PARP Inhibitor XII, PARP Inhibitor XII 1PC X 5MG. Offered by: Biosynth, Sigma-Aldrich. Available pack sizes: 1mg, 5mg, 10mg.
3-(4-chlorophenyl)quinoxaline-5-carboxamide (CAS 489457-67-2) is a chemical compound with the molecular formula C15H10ClN3O and a molecular weight of 283.71 g/mol. IUPAC name: 3-(4-chlorophenyl)quinoxaline-5-carboxamide. InChIKey: FLYGLPYJEQPCFY-UHFFFAOYSA-N.
| Molecular formula | C15H10ClN3O |
|---|---|
| Molecular weight | 283.71 g/mol |
| IUPAC name | 3-(4-chlorophenyl)quinoxaline-5-carboxamide |
| InChIKey | FLYGLPYJEQPCFY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N=CC(=N2)C3=CC=C(C=C3)Cl)C(=O)N |
Computed by PubChem (NCBI)