CAS 4915-82-6 is the registry number for 2-Benzyl-1H-imidazol-4(5H)-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-benzyl-1,4-dihydroimidazol-5-one (CAS 4915-82-6) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 2-benzyl-1,4-dihydroimidazol-5-one. InChIKey: VCXFFJBFAQMZHY-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2-benzyl-1,4-dihydroimidazol-5-one |
| InChIKey | VCXFFJBFAQMZHY-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=N1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)