Products 491601-44-6

CAS 491601-44-6 is the registry number for 2-Butyl-5,6-dimethoxy-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-butyl-5,6-dimethoxy-1H-indole (CAS 491601-44-6) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: 2-butyl-5,6-dimethoxy-1H-indole. InChIKey: BIEKJKUYSJMBIO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO2
Molecular weight233.31 g/mol
IUPAC name2-butyl-5,6-dimethoxy-1H-indole
InChIKeyBIEKJKUYSJMBIO-UHFFFAOYSA-N
SMILESCCCCC1=CC2=CC(=C(C=C2N1)OC)OC

Computed by PubChem (NCBI)