Products 491833-28-4
CAS 491833-28-4 appears in our catalog under these names: Eliglustat Impurity 10, N-des-octanamide Eliglustat. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(1R,2R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropan-1-ol (CAS 491833-28-4) is a chemical compound with the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. IUPAC name: (1R,2R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropan-1-ol. InChIKey: MPRDYMIZJFVAAH-IUODEOHRSA-N.
| Molecular formula | C15H22N2O3 |
|---|---|
| Molecular weight | 278.35 g/mol |
| IUPAC name | (1R,2R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropan-1-ol |
| InChIKey | MPRDYMIZJFVAAH-IUODEOHRSA-N |
| SMILES | C1CCN(C1)C[C@H]([C@@H](C2=CC3=C(C=C2)OCCO3)O)N |
Computed by PubChem (NCBI)