CAS 4922-98-9 appears in our catalog under these names: 5-Phenyl-4h-1,2,4-triazol-3-amine, 5–phenyl–4H–1,2,4–triazol–3–amine, 5-Phenyl-1H-1,2,4-triazol-3-amine, >98.0%(GC)(T), 5-Phenyl-1H-1,2,4-triazol-3-amine 97%, 5-Phenyl-4H-1,2,4-triazol-3-amine, 97%, 97%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 25g, 100g, 2.5g.
5-phenyl-1H-1,2,4-triazol-3-amine (CAS 4922-98-9) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: 5-phenyl-1H-1,2,4-triazol-3-amine. InChIKey: GHUDJFJZFUVPIQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | 5-phenyl-1H-1,2,4-triazol-3-amine |
| InChIKey | GHUDJFJZFUVPIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=NN2)N |
Computed by PubChem (NCBI)