Products 493-44-7
CAS 493-44-7 is the registry number for 5,7,3',4',5'-Pentahydroxyflavan. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(2S)-5,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl]benzene-1,2,3-triol (CAS 493-44-7) is a chemical compound with the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. IUPAC name: 5-[(2S)-5,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl]benzene-1,2,3-triol. InChIKey: VBMMNHVFWRTWNL-ZDUSSCGKSA-N.
| Molecular formula | C15H14O6 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | 5-[(2S)-5,7-dihydroxy-3,4-dihydro-2H-chromen-2-yl]benzene-1,2,3-triol |
| InChIKey | VBMMNHVFWRTWNL-ZDUSSCGKSA-N |
| SMILES | C1CC2=C(C=C(C=C2O[C@@H]1C3=CC(=C(C(=C3)O)O)O)O)O |
Computed by PubChem (NCBI)