Products 4933-84-0
CAS 4933-84-0 appears in our catalog under these names: scyllo-Inosamine hydrochloride, 1-Amino-1-deoxy-scyllo-inositol hydrochloride. Offered by: Biosynth, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 2mg.
6-aminocyclohexane-1,2,3,4,5-pentol;hydrochloride (CAS 4933-84-0) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: 6-aminocyclohexane-1,2,3,4,5-pentol;hydrochloride. InChIKey: ZIXPBLLUBGYJGK-UHFFFAOYSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | 6-aminocyclohexane-1,2,3,4,5-pentol;hydrochloride |
| InChIKey | ZIXPBLLUBGYJGK-UHFFFAOYSA-N |
| SMILES | C1(C(C(C(C(C1O)O)O)O)O)N.Cl |
Computed by PubChem (NCBI)