CAS 494846-26-3 appears in our catalog under these names: trans–2,2–dimethyl–3–phenylcyclopropane–1–carboxylic acid, trans-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
Trans-(1R,3R)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid (CAS 494846-26-3) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: trans-(1R,3R)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid. InChIKey: BPPWVIXNARUAKK-ZJUUUORDSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | trans-(1R,3R)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid |
| InChIKey | BPPWVIXNARUAKK-ZJUUUORDSA-N |
| SMILES | CC1([C@@H]([C@H]1C(=O)O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)