Products 494846-57-0

CAS 494846-57-0 is the registry number for (1S,3S)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Trans-(1S,3S)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid (CAS 494846-57-0) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: trans-(1S,3S)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid. InChIKey: BPPWVIXNARUAKK-VHSXEESVSA-N.

Identity
Molecular formulaC12H14O2
Molecular weight190.24 g/mol
IUPAC nametrans-(1S,3S)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid
InChIKeyBPPWVIXNARUAKK-VHSXEESVSA-N
SMILESCC1([C@H]([C@@H]1C(=O)O)C2=CC=CC=C2)C

Computed by PubChem (NCBI)