Products 99647-69-5
CAS 99647-69-5 appears in our catalog under these names: rac-(1R,3R)-2,2-Dimethyl-3-phenylcyclopropane-1-carboxylic acid, Trans-2,2-dimethyl-3-phenylcyclopropanecarboxylic acid, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 1g.
Trans-(1R,3R)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid (CAS 99647-69-5) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: trans-(1R,3R)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid. InChIKey: BPPWVIXNARUAKK-ZJUUUORDSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | trans-(1R,3R)-2,2-dimethyl-3-phenylcyclopropane-1-carboxylic acid |
| InChIKey | BPPWVIXNARUAKK-ZJUUUORDSA-N |
| SMILES | CC1([C@@H]([C@H]1C(=O)O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)