CAS 496930-10-0 appears in our catalog under these names: (R)-2-Amino-3-(6-bromo-1h-indol-3-yl)propanoic acid, 95%, (R)-2-Amino-3-(6-bromo-1H-indol-3-yl)propanoic acid, 95%, 95%, H-D-Trp(6-Br)-OH, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 500mg, 100mg, 250mg, 1g, 5g.
(2R)-2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid (CAS 496930-10-0) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: (2R)-2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid. InChIKey: OAORYCZPERQARS-SECBINFHSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | (2R)-2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | OAORYCZPERQARS-SECBINFHSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC=C2C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)