CAS 49759-58-2 appears in our catalog under these names: Cbz-Phe(4-Me)-OH 98%, (S)-2-(((Benzyloxy)carbonyl)amino)-3-(p-tolyl)propanoic acid, ≥98%, ≥98%, (S)-2-(((Benzyloxy)carbonyl)amino)-3-(p-tolyl)propanoic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
(2S)-3-(4-methylphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 49759-58-2) is a chemical compound with the molecular formula C18H19NO4 and a molecular weight of 313.3 g/mol. IUPAC name: (2S)-3-(4-methylphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: CSDULTGTPASESO-INIZCTEOSA-N.
| Molecular formula | C18H19NO4 |
|---|---|
| Molecular weight | 313.3 g/mol |
| IUPAC name | (2S)-3-(4-methylphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | CSDULTGTPASESO-INIZCTEOSA-N |
| SMILES | CC1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)