CAS 498-43-1 appears in our catalog under these names: (2R,4S,5R)-2,4,5,6-Tetrahydroxyhexanoic acid, 98%, 3-Deoxy-D-ribo-hexonic acid. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4S,5R)-2,4,5,6-tetrahydroxyhexanoic acid (CAS 498-43-1) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. IUPAC name: (2R,4S,5R)-2,4,5,6-tetrahydroxyhexanoic acid. InChIKey: YGMNHEPVTNXLLS-VPENINKCSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (2R,4S,5R)-2,4,5,6-tetrahydroxyhexanoic acid |
| InChIKey | YGMNHEPVTNXLLS-VPENINKCSA-N |
| SMILES | C([C@@H]([C@@H](CO)O)O)[C@H](C(=O)O)O |
Computed by PubChem (NCBI)