Products 49849-71-0
CAS 49849-71-0 is the registry number for 7-Bromo-3-methyl-3,4-dihydroquinoxalin-2(1H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
7-bromo-3-methyl-3,4-dihydro-1H-quinoxalin-2-one (CAS 49849-71-0) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 7-bromo-3-methyl-3,4-dihydro-1H-quinoxalin-2-one. InChIKey: KIVJGGNEHZDPNV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 7-bromo-3-methyl-3,4-dihydro-1H-quinoxalin-2-one |
| InChIKey | KIVJGGNEHZDPNV-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=C(N1)C=CC(=C2)Br |
Computed by PubChem (NCBI)