CAS 498546-34-2 is the registry number for 3-Chloro-4-nitro-2-naphthalenecarboxylic Acid. Offered by: TRC. Available pack sizes: 1g.
3-chloro-4-nitronaphthalene-2-carboxylic acid (CAS 498546-34-2) is a chemical compound with the molecular formula C11H6ClNO4 and a molecular weight of 251.62 g/mol. IUPAC name: 3-chloro-4-nitronaphthalene-2-carboxylic acid. InChIKey: MNCHWWUECUYGGJ-UHFFFAOYSA-N.
| Molecular formula | C11H6ClNO4 |
|---|---|
| Molecular weight | 251.62 g/mol |
| IUPAC name | 3-chloro-4-nitronaphthalene-2-carboxylic acid |
| InChIKey | MNCHWWUECUYGGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2[N+](=O)[O-])Cl)C(=O)O |
Computed by PubChem (NCBI)