CAS 62482-28-4 appears in our catalog under these names: 6-Chloroquinoline-2,4-dicarboxylic acid, 95%, 6–Chloroquinoline–2,4–dicarboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
6-chloroquinoline-2,4-dicarboxylic acid (CAS 62482-28-4) is a chemical compound with the molecular formula C11H6ClNO4 and a molecular weight of 251.62 g/mol. IUPAC name: 6-chloroquinoline-2,4-dicarboxylic acid. InChIKey: ILQAFAWQKBSEDK-UHFFFAOYSA-N.
| Molecular formula | C11H6ClNO4 |
|---|---|
| Molecular weight | 251.62 g/mol |
| IUPAC name | 6-chloroquinoline-2,4-dicarboxylic acid |
| InChIKey | ILQAFAWQKBSEDK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CC(=N2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)