Products 61941-88-6

CAS 61941-88-6 appears in our catalog under these names: 5-(2-Nitro-phenyl)-furan-2-carbonyl chloride, 95%, 5-(2-Nitrophenyl)furan-2-carbonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-(2-nitrophenyl)furan-2-carbonyl chloride (CAS 61941-88-6) is a chemical compound with the molecular formula C11H6ClNO4 and a molecular weight of 251.62 g/mol. IUPAC name: 5-(2-nitrophenyl)furan-2-carbonyl chloride. InChIKey: RRWHGDGMPQFABA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6ClNO4
Molecular weight251.62 g/mol
IUPAC name5-(2-nitrophenyl)furan-2-carbonyl chloride
InChIKeyRRWHGDGMPQFABA-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C2=CC=C(O2)C(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)