CAS 499-02-5 appears in our catalog under these names: trans-3-Methylenecyclopropane-1,2-dicarboxylic acid, 95+%, 3-Methylenecyclopropane-trans-1,2-dicarboxylic Acid. Offered by: AmBeed, TRC. Available pack sizes: 5g, 1g.
Trans-(1S,2S)-3-methylidenecyclopropane-1,2-dicarboxylic acid (CAS 499-02-5) is a chemical compound with the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. IUPAC name: trans-(1S,2S)-3-methylidenecyclopropane-1,2-dicarboxylic acid. InChIKey: XZVHROKAQFFOCA-QWWZWVQMSA-N.
| Molecular formula | C6H6O4 |
|---|---|
| Molecular weight | 142.11 g/mol |
| IUPAC name | trans-(1S,2S)-3-methylidenecyclopropane-1,2-dicarboxylic acid |
| InChIKey | XZVHROKAQFFOCA-QWWZWVQMSA-N |
| SMILES | C=C1[C@H]([C@@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)