Products 499770-87-5
CAS 499770-87-5 is the registry number for (1-Methyl-3-phenyl-1H-pyrazol-4-yl)methanol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1-methyl-3-phenylpyrazol-4-yl)methanol (CAS 499770-87-5) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: (1-methyl-3-phenylpyrazol-4-yl)methanol. InChIKey: UWAIFNHWQVDCRD-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | (1-methyl-3-phenylpyrazol-4-yl)methanol |
| InChIKey | UWAIFNHWQVDCRD-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C2=CC=CC=C2)CO |
Computed by PubChem (NCBI)