Products 501431-06-7
CAS 501431-06-7 is the registry number for Ethyl (1s,3s,4s,5r)-rel-2-boc-5-hydroxy-2-azabicyclo[2.2.1]heptane-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg, 1g.
2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate (CAS 501431-06-7) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate. InChIKey: SDBVUDYZBFDQKN-ZDCRXTMVSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 2-O-tert-butyl 3-O-ethyl (1S,3S,4S,5R)-5-hydroxy-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| InChIKey | SDBVUDYZBFDQKN-ZDCRXTMVSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C[C@H](N1C(=O)OC(C)(C)C)C[C@H]2O |
Computed by PubChem (NCBI)