CAS 1180519-44-1 appears in our catalog under these names: 1,3-Di-tert-butyl 2-oxopyrrolidine-1,3-dicarboxylate, 95%, Di-tert-butyl 2-oxopyrrolidine-1,3-dicarboxylate, 95+%, Di–tert–butyl 2–oxopyrrolidine–1,3–dicarboxylate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ditert-butyl 2-oxopyrrolidine-1,3-dicarboxylate (CAS 1180519-44-1) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: ditert-butyl 2-oxopyrrolidine-1,3-dicarboxylate. InChIKey: QIXUDIGRBAMTIG-UHFFFAOYSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | ditert-butyl 2-oxopyrrolidine-1,3-dicarboxylate |
| InChIKey | QIXUDIGRBAMTIG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CCN(C1=O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)