CAS 1253791-57-9 appears in our catalog under these names: 1-tert-Butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate, 95%, 1–tert–Butyl 4–ethyl 4–formylpiperidine–1,4–dicarboxylate, 1-tert-Butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate, 1-tert-Butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate, ≥95%, ≥95%, 1-tert-Butyl 4-ethyl 4-formylpiperidine-1,4-dicarboxylate, ≥95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
1-O-tert-butyl 4-O-ethyl 4-formylpiperidine-1,4-dicarboxylate (CAS 1253791-57-9) is a chemical compound with the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-formylpiperidine-1,4-dicarboxylate. InChIKey: PKEYJCKTQWJLCD-UHFFFAOYSA-N.
| Molecular formula | C14H23NO5 |
|---|---|
| Molecular weight | 285.34 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl 4-formylpiperidine-1,4-dicarboxylate |
| InChIKey | PKEYJCKTQWJLCD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)C=O |
Computed by PubChem (NCBI)