CAS 501446-96-4 is the registry number for 4-(1,2,3,4-Tetrahydroquinazolin-2-yl)phenol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-(1,2,3,4-tetrahydroquinazolin-2-yl)phenol (CAS 501446-96-4) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 4-(1,2,3,4-tetrahydroquinazolin-2-yl)phenol. InChIKey: UJAGRKYVZDUYPT-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 4-(1,2,3,4-tetrahydroquinazolin-2-yl)phenol |
| InChIKey | UJAGRKYVZDUYPT-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2NC(N1)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)