Products 501653-39-0
CAS 501653-39-0 appears in our catalog under these names: Methyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate, Methyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate, 97%, 97%, methyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 25g.
Methyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate (CAS 501653-39-0) is a chemical compound with the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. IUPAC name: methyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate. InChIKey: WFBPPBRBWLJXTK-UHFFFAOYSA-N.
| Molecular formula | C12H12O5 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | methyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | WFBPPBRBWLJXTK-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)CC(=O)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
methyl 4-(3-methoxyphenyl)-2,4-dioxobutanoate, Methyl 3-methoxy-a,g-dioxo-benzenebutanoate, 4-(3-Methoxy-phenyl)-2,4-dioxo-butyric acid methyl ester, methyl4-(3-methoxyphenyl)-2,4-dioxobutanoate, methyl 4-(3-methoxyphenyl)-2,4-dioxo-butanoate, Methyl 3-methoxy-alpha,gamma-dioxobenzenebutanoate, 4-(3-Methoxyphenyl)-2,4-dioxobutyric acid methyl ester, Benzenebutanoic acid, 3-methoxy-alpha,gamma-dioxo-, methyl ester