Products 501914-49-4

CAS 501914-49-4 is the registry number for 2-{2-((2-methoxyphenyl)amino)-4-phenyl-1,3-thiazol-5-yl}acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-[2-(2-methoxyanilino)-4-phenyl-1,3-thiazol-5-yl]acetic acid (CAS 501914-49-4) is a chemical compound with the molecular formula C18H16N2O3S and a molecular weight of 340.4 g/mol. IUPAC name: 2-[2-(2-methoxyanilino)-4-phenyl-1,3-thiazol-5-yl]acetic acid. InChIKey: ZCFXJXOEDBZELJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16N2O3S
Molecular weight340.4 g/mol
IUPAC name2-[2-(2-methoxyanilino)-4-phenyl-1,3-thiazol-5-yl]acetic acid
InChIKeyZCFXJXOEDBZELJ-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1NC2=NC(=C(S2)CC(=O)O)C3=CC=CC=C3

Computed by PubChem (NCBI)