CAS 736963-55-6 is the registry number for N-(4-(2-cyano-2-((4-methylphenyl)sulfonyl)vinyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-[(E)-2-cyano-2-(4-methylphenyl)sulfonylethenyl]phenyl]acetamide (CAS 736963-55-6) is a chemical compound with the molecular formula C18H16N2O3S and a molecular weight of 340.4 g/mol. IUPAC name: N-[4-[(E)-2-cyano-2-(4-methylphenyl)sulfonylethenyl]phenyl]acetamide. InChIKey: IYIRQOTXCCWTCV-WOJGMQOQSA-N.
| Molecular formula | C18H16N2O3S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | N-[4-[(E)-2-cyano-2-(4-methylphenyl)sulfonylethenyl]phenyl]acetamide |
| InChIKey | IYIRQOTXCCWTCV-WOJGMQOQSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)/C(=C/C2=CC=C(C=C2)NC(=O)C)/C#N |
Computed by PubChem (NCBI)