Products 869709-61-5
CAS 869709-61-5 is the registry number for 2-(Benzyl(methyl)amino)-2-oxoethyl benzo[d]thiazole-6-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
[2-[benzyl(methyl)amino]-2-oxoethyl] 1,3-benzothiazole-6-carboxylate (CAS 869709-61-5) is a chemical compound with the molecular formula C18H16N2O3S and a molecular weight of 340.4 g/mol. IUPAC name: [2-[benzyl(methyl)amino]-2-oxoethyl] 1,3-benzothiazole-6-carboxylate. InChIKey: LLHVZSFINMQQPV-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O3S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | [2-[benzyl(methyl)amino]-2-oxoethyl] 1,3-benzothiazole-6-carboxylate |
| InChIKey | LLHVZSFINMQQPV-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=CC=C1)C(=O)COC(=O)C2=CC3=C(C=C2)N=CS3 |
Computed by PubChem (NCBI)