Products 5027-76-9
CAS 5027-76-9 appears in our catalog under these names: Oleuropeic acid, Oleuropeic acid, Oleuropeic acid, 98.0%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 10mg, 1mg, 2mg, 5mg, Get quote.
(4S)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylic acid (CAS 5027-76-9) is a chemical compound with the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. IUPAC name: (4S)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylic acid. InChIKey: BFYWJELXORKNFO-MRVPVSSYSA-N.
| Molecular formula | C10H16O3 |
|---|---|
| Molecular weight | 184.23 g/mol |
| IUPAC name | (4S)-4-(2-hydroxypropan-2-yl)cyclohexene-1-carboxylic acid |
| InChIKey | BFYWJELXORKNFO-MRVPVSSYSA-N |
| SMILES | CC(C)([C@H]1CCC(=CC1)C(=O)O)O |
Computed by PubChem (NCBI)