Products 5027-84-9
CAS 5027-84-9 is the registry number for Pyridoxine-d2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[dideuterio(hydroxy)methyl]-4-(hydroxymethyl)-2-methylpyridin-3-ol (CAS 5027-84-9) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 171.19 g/mol. IUPAC name: 5-[dideuterio(hydroxy)methyl]-4-(hydroxymethyl)-2-methylpyridin-3-ol. InChIKey: LXNHXLLTXMVWPM-SMZGMGDZSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 5-[dideuterio(hydroxy)methyl]-4-(hydroxymethyl)-2-methylpyridin-3-ol |
| InChIKey | LXNHXLLTXMVWPM-SMZGMGDZSA-N |
| SMILES | [2H]C([2H])(C1=CN=C(C(=C1CO)O)C)O |
Computed by PubChem (NCBI)