CAS 503417-39-8 appears in our catalog under these names: 1-(Naphthalen-1-yl)cyclopropanamine 95%, 1-(Naphthalen-1-yl)cyclopropanamine, 95%(GC-MS),RG, 95%(GC-MS),RG. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
1-naphthalen-1-ylcyclopropan-1-amine (CAS 503417-39-8) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 1-naphthalen-1-ylcyclopropan-1-amine. InChIKey: ZBHKDZNJLCDLEC-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 1-naphthalen-1-ylcyclopropan-1-amine |
| InChIKey | ZBHKDZNJLCDLEC-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC3=CC=CC=C32)N |
Computed by PubChem (NCBI)