CAS 50358-35-5 appears in our catalog under these names: 5–Amino–6–methylquinoline, 6-Methyl-5-quinolinamine, 6-Methylquinolin-5-amine 98+%, 6-Methyl-quinolin-5-ylamine, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 100mg, 5g.
6-methylquinolin-5-amine (CAS 50358-35-5) is a chemical compound with the molecular formula C10H10N2 and a molecular weight of 158.20 g/mol. IUPAC name: 6-methylquinolin-5-amine. InChIKey: KQIDQFHIEFDWPM-UHFFFAOYSA-N.
| Molecular formula | C10H10N2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | 6-methylquinolin-5-amine |
| InChIKey | KQIDQFHIEFDWPM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)N=CC=C2)N |
Computed by PubChem (NCBI)