CAS 503860-58-0 is the registry number for (S)-4-Benzyl-2-(4-fluorophenyl)morpholine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(2S)-2-(4-fluorophenyl)morpholine;hydrochloride (CAS 503860-58-0) is a chemical compound with the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. IUPAC name: (2S)-2-(4-fluorophenyl)morpholine;hydrochloride. InChIKey: OVIHXYHYVKMHCN-HNCPQSOCSA-N.
| Molecular formula | C10H13ClFNO |
|---|---|
| Molecular weight | 217.67 g/mol |
| IUPAC name | (2S)-2-(4-fluorophenyl)morpholine;hydrochloride |
| InChIKey | OVIHXYHYVKMHCN-HNCPQSOCSA-N |
| SMILES | C1CO[C@H](CN1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)