CAS 50402-52-3 is the registry number for 1,2,3-Trichloronaphthalene, >95% (GC). Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
1,2,3-trichloronaphthalene (CAS 50402-52-3) is a chemical compound with the molecular formula C10H5Cl3 and a molecular weight of 231.5 g/mol. IUPAC name: 1,2,3-trichloronaphthalene. InChIKey: QEPTXDCPBXMWJC-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl3 |
|---|---|
| Molecular weight | 231.5 g/mol |
| IUPAC name | 1,2,3-trichloronaphthalene |
| InChIKey | QEPTXDCPBXMWJC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2Cl)Cl)Cl |
Computed by PubChem (NCBI)