CAS 55720-40-6 is the registry number for 2,3,6-Trichloronaphthalene, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
2,3,6-trichloronaphthalene (CAS 55720-40-6) is a chemical compound with the molecular formula C10H5Cl3 and a molecular weight of 231.5 g/mol. IUPAC name: 2,3,6-trichloronaphthalene. InChIKey: ZYTLBFKRYKUCMJ-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl3 |
|---|---|
| Molecular weight | 231.5 g/mol |
| IUPAC name | 2,3,6-trichloronaphthalene |
| InChIKey | ZYTLBFKRYKUCMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)Cl)Cl)Cl |
Computed by PubChem (NCBI)