CAS 50445-50-6 appears in our catalog under these names: N-Ethyl-4-nitrobenzamide, 98%, N-ethyl-4-nitrobenzamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g.
N-ethyl-4-nitrobenzamide (CAS 50445-50-6) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: N-ethyl-4-nitrobenzamide. InChIKey: RZUZNEBLPIHWAR-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | N-ethyl-4-nitrobenzamide |
| InChIKey | RZUZNEBLPIHWAR-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)