CAS 50463-74-6 appears in our catalog under these names: 3,4-Dimethoxy-Alpha-methyl-benzeneacetic Acid, 2-(3,4-Dimethoxyphenyl)propanoic acid, 2-(3,4-Dimethoxyphenyl)propanoic acid 94%. Offered by: TRC, Biosynth, Ambeed. Available pack sizes: 100mg, 250mg, 50mg, 1g.
2-(3,4-dimethoxyphenyl)propanoic acid (CAS 50463-74-6) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)propanoic acid. InChIKey: KWOMNGWHOBWKBP-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)propanoic acid |
| InChIKey | KWOMNGWHOBWKBP-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)