Products 50505-81-2
CAS 50505-81-2 is the registry number for (+)-p-Methoxyamphetamine Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 750mg, 5000mg.
(2S)-1-(4-methoxyphenyl)propan-2-amine;hydrochloride (CAS 50505-81-2) is a chemical compound with the molecular formula C10H16ClNO and a molecular weight of 201.69 g/mol. IUPAC name: (2S)-1-(4-methoxyphenyl)propan-2-amine;hydrochloride. InChIKey: VSHZXOLHFRVZND-QRPNPIFTSA-N.
| Molecular formula | C10H16ClNO |
|---|---|
| Molecular weight | 201.69 g/mol |
| IUPAC name | (2S)-1-(4-methoxyphenyl)propan-2-amine;hydrochloride |
| InChIKey | VSHZXOLHFRVZND-QRPNPIFTSA-N |
| SMILES | C[C@@H](CC1=CC=C(C=C1)OC)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Methoxyamphetamine hydrochloride, (S)-, (+)-p-Methoxyamphetamine hydrochloride, Pma hydrochloride, (S)-, 4-Ma hydrochloride, (S)-, (2S)-1-(4-methoxyphenyl)propan-2-amine hydrochloride, D-p-Methoxyamphetamine hydrochloride, D-Para-methoxyamphetamine hydrochloride, Pma (psychedelic) hydrochloride, (S)-, (s)-(+)-4-methoxyamphetamine hydrochloride, Para-methoxyamphetamine hydrochloride, (S)-