Products 50625-55-3
CAS 50625-55-3 appears in our catalog under these names: 2,4-Dimethoxy-5-methylbenzoic acid, 95%, 2,4-Dimethoxy-5-methylbenzoic acid, 97%, 2,4-Dimethoxy-5-methylbenzoic acid, 2,4-Dimethoxy-5-methylbenzoic acid, ≥99.8%, ≥99.8%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 1000mg, 500mg, 2000mg, 5000mg.
2,4-dimethoxy-5-methylbenzoic acid (CAS 50625-55-3) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: 2,4-dimethoxy-5-methylbenzoic acid. InChIKey: WQBKBHAIWAXLPZ-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 2,4-dimethoxy-5-methylbenzoic acid |
| InChIKey | WQBKBHAIWAXLPZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)OC)C(=O)O |
Computed by PubChem (NCBI)