4-Bromo-1-naphthaldehyde, 95%, 95%
cas: 50672-84-9 — see every product listed under this CAS number, including other names
4-Bromo-1-naphthaldehyde, 95%, 95% (CAS 50672-84-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148EA-100mg |
| cas | 50672-84-9 |
| size | 100mg |
| availability | 250g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 189.20 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 25g | 438.80 Pln | |
| Chemat | 50g | 568.40 Pln | |
| Chemat | 100g | 938.00 Pln | |
| Chemat | 250g | 1898.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-bromonaphthalene-1-carbaldehyde (CAS 50672-84-9) is a chemical compound with the molecular formula C11H7BrO and a molecular weight of 235.08 g/mol. IUPAC name: 4-bromonaphthalene-1-carbaldehyde. InChIKey: SESASPRCAIMYLA-UHFFFAOYSA-N.
| Molecular formula | C11H7BrO |
|---|---|
| Molecular weight | 235.08 g/mol |
| IUPAC name | 4-bromonaphthalene-1-carbaldehyde |
| InChIKey | SESASPRCAIMYLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)C=O |
Computed by PubChem (NCBI)