CAS 507264-54-2 appears in our catalog under these names: 2-{((tert-Butoxy)carbonyl)amino}-4,4-dimethylpentanoic acid, N-Boc-3-t-butyl-dl-alanine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 1g.
4,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 507264-54-2) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: 4,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: PUQVQDMFCAGQQB-UHFFFAOYSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | 4,4-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | PUQVQDMFCAGQQB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)