Products 50727-07-6
CAS 50727-07-6 is the registry number for 5-(Tert-butyl)isoindoline-1,3-dione, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-tert-butylisoindole-1,3-dione (CAS 50727-07-6) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: 5-tert-butylisoindole-1,3-dione. InChIKey: MQAXXSNRKXXVON-UHFFFAOYSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 5-tert-butylisoindole-1,3-dione |
| InChIKey | MQAXXSNRKXXVON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)C(=O)NC2=O |
Computed by PubChem (NCBI)
Synonyms:
5-(tert-Butyl)isoindoline-1,3-dione, 5-tert-butylisoindoline-1,3-dione, 5-(tert-Butyl)phthalimide, 5-tert-butylisoindole-1,3-dione, 4-t-butylphthalimide, 1H-Isoindole-1,3(2H)-dione, 5-(1,1-dimethylethyl)-, 4-t-butyl-phthalimide, CBMicro_016467, Oprea1_157335, 5-(t-Butyl)isoindoline-1,3-dione