Products 50743-49-2
CAS 50743-49-2 is the registry number for AA 344. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-ethyl-3-(2H-tetrazol-5-yl)chromen-4-one (CAS 50743-49-2) is a chemical compound with the molecular formula C12H10N4O2 and a molecular weight of 242.23 g/mol. IUPAC name: 6-ethyl-3-(2H-tetrazol-5-yl)chromen-4-one. InChIKey: UBEONZHRYRTJFN-UHFFFAOYSA-N.
| Molecular formula | C12H10N4O2 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 6-ethyl-3-(2H-tetrazol-5-yl)chromen-4-one |
| InChIKey | UBEONZHRYRTJFN-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)OC=C(C2=O)C3=NNN=N3 |
Computed by PubChem (NCBI)