CAS 50765-03-2 is the registry number for rel-(1R,2S)-2-Phenylcyclobutan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2S)-2-phenylcyclobutan-1-amine;hydrochloride (CAS 50765-03-2) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: trans-(1R,2S)-2-phenylcyclobutan-1-amine;hydrochloride. InChIKey: XRWXBXHIAUZHMB-BAUSSPIASA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | trans-(1R,2S)-2-phenylcyclobutan-1-amine;hydrochloride |
| InChIKey | XRWXBXHIAUZHMB-BAUSSPIASA-N |
| SMILES | C1C[C@H]([C@@H]1C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)